cas: 850568-71-7 — see every product listed under this CAS number, including other names
Quinoline-3-boronic acid, HCl, ≥98%, ≥98% (CAS 850568-71-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115S0M-1g |
| cas | 850568-71-7 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 554.00 Pln | |
| Chemat | 25g | 2426.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
Quinolin-3-ylboronic acid;hydrochloride (CAS 850568-71-7) is a chemical compound with the molecular formula C9H9BClNO2 and a molecular weight of 209.44 g/mol. IUPAC name: quinolin-3-ylboronic acid;hydrochloride. InChIKey: BQFQABXCFQWPGH-UHFFFAOYSA-N.
| Molecular formula | C9H9BClNO2 |
|---|---|
| Molecular weight | 209.44 g/mol |
| IUPAC name | quinolin-3-ylboronic acid;hydrochloride |
| InChIKey | BQFQABXCFQWPGH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2N=C1)(O)O.Cl |
Computed by PubChem (NCBI)