cas: 1199-03-7 — see every product listed under this CAS number, including other names
Quinoxaline-2,3-dithiol (CAS 1199-03-7) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 10mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PU0-2mg |
| cas | 1199-03-7 |
| size | 2mg |
| availability | 0.01g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 2mg | 194.00 Pln | |
| Chemat | 10mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
1,4-dihydroquinoxaline-2,3-dithione (CAS 1199-03-7) is a chemical compound with the molecular formula C8H6N2S2 and a molecular weight of 194.3 g/mol. IUPAC name: 1,4-dihydroquinoxaline-2,3-dithione. InChIKey: YFBUDXNMBTUSOC-UHFFFAOYSA-N.
| Molecular formula | C8H6N2S2 |
|---|---|
| Molecular weight | 194.3 g/mol |
| IUPAC name | 1,4-dihydroquinoxaline-2,3-dithione |
| InChIKey | YFBUDXNMBTUSOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=S)C(=S)N2 |
Computed by PubChem (NCBI)