CAS 5585-19-3 appears in our catalog under these names: 5-Phenyl-1,3,4-thiadiazole-2-thiol, 95%, 5-Phenyl-1,3,4-thiadiazole-2-thiol, 96% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 500mg.
5-phenyl-3H-1,3,4-thiadiazole-2-thione (CAS 5585-19-3) is a chemical compound with the molecular formula C8H6N2S2 and a molecular weight of 194.3 g/mol. IUPAC name: 5-phenyl-3H-1,3,4-thiadiazole-2-thione. InChIKey: ZTLMHGOWADYAHM-UHFFFAOYSA-N.
| Molecular formula | C8H6N2S2 |
|---|---|
| Molecular weight | 194.3 g/mol |
| IUPAC name | 5-phenyl-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | ZTLMHGOWADYAHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=S)S2 |
Computed by PubChem (NCBI)