CAS 1199-03-7 appears in our catalog under these names: Quinoxaline-2,3-dithiol, 95%, Quinoxaline-2,3-dithiol, 98%, Quinoxaline-2,3-dithiol. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 2mg, 10mg.
1,4-dihydroquinoxaline-2,3-dithione (CAS 1199-03-7) is a chemical compound with the molecular formula C8H6N2S2 and a molecular weight of 194.3 g/mol. IUPAC name: 1,4-dihydroquinoxaline-2,3-dithione. InChIKey: YFBUDXNMBTUSOC-UHFFFAOYSA-N.
| Molecular formula | C8H6N2S2 |
|---|---|
| Molecular weight | 194.3 g/mol |
| IUPAC name | 1,4-dihydroquinoxaline-2,3-dithione |
| InChIKey | YFBUDXNMBTUSOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=S)C(=S)N2 |
Computed by PubChem (NCBI)