R-(-)-Clopidogrel Hydrogen Sulfate 98%
cas: 120202-71-3 — see every product listed under this CAS number, including other names
R-(-)-Clopidogrel Hydrogen Sulfate 98% (CAS 120202-71-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A373523-50mg |
| cas | 120202-71-3 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 509.44 Pln | |
| Ambeed | 100mg | 809.81 Pln | |
| Ambeed | 250mg | 1260.38 Pln | |
| Ambeed | 1g | 3084.88 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A373523 |
Methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid (CAS 120202-71-3) is a chemical compound with the molecular formula C16H18ClNO6S2 and a molecular weight of 419.9 g/mol. IUPAC name: methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid. InChIKey: FDEODCTUSIWGLK-XFULWGLBSA-N.
| Molecular formula | C16H18ClNO6S2 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid |
| InChIKey | FDEODCTUSIWGLK-XFULWGLBSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.OS(=O)(=O)O |
Computed by PubChem (NCBI)