cas: 120202-71-3 — see every product listed under this CAS number, including other names
(R)-Methyl 2-(2-chlorophenyl)-2-(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate, 98% (CAS 120202-71-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F556894-50MG |
| cas | 120202-71-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 643.54 Pln | |
| Fluorochem | 100mg | 981.96 Pln | |
| Fluorochem | 250mg | 1445.34 Pln | |
| Fluorochem | 1g | 3278.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid (CAS 120202-71-3) is a chemical compound with the molecular formula C16H18ClNO6S2 and a molecular weight of 419.9 g/mol. IUPAC name: methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid. InChIKey: FDEODCTUSIWGLK-XFULWGLBSA-N.
| Molecular formula | C16H18ClNO6S2 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid |
| InChIKey | FDEODCTUSIWGLK-XFULWGLBSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.OS(=O)(=O)O |
Computed by PubChem (NCBI)