CAS 1219274-96-0 appears in our catalog under these names: rac-Clopidogrel-d4 Hydrogen Sulfate, rac Clopidogrel-d4 Hydrogen Sulfate, >95% (HPLC), (±)-Clopidogrel-d4 Hydrogen Sulfate (2-chlorophenyl-d4), 98 atom % D, min 97% Chemical Purity, Clopidogrel-d4 (sulfate). Offered by: Chemat Brand, TRC, CDN, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 0,01g, 0,005g, 5 mg, 1 mg.
Methyl 2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid (CAS 1219274-96-0) is a chemical compound with the molecular formula C16H18ClNO6S2 and a molecular weight of 423.9 g/mol. IUPAC name: methyl 2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid. InChIKey: FDEODCTUSIWGLK-QZFMBAIXSA-N.
| Molecular formula | C16H18ClNO6S2 |
|---|---|
| Molecular weight | 423.9 g/mol |
| IUPAC name | methyl 2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid |
| InChIKey | FDEODCTUSIWGLK-QZFMBAIXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(C(=O)OC)N2CCC3=C(C2)C=CS3)Cl)[2H])[2H].OS(=O)(=O)O |
Computed by PubChem (NCBI)