CAS 361457-01-4 appears in our catalog under these names: RO3244794/ 99.36% (existing batch purity), RO3244794, 99.64%. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg, 10 mg.
(2R)-3-(4-fluorophenyl)-2-[[5-(4-fluorophenyl)-1-benzofuran-2-yl]methoxycarbonylamino]propanoic acid (CAS 361457-01-4) is a chemical compound with the molecular formula C25H19F2NO5 and a molecular weight of 451.4 g/mol. IUPAC name: (2R)-3-(4-fluorophenyl)-2-[[5-(4-fluorophenyl)-1-benzofuran-2-yl]methoxycarbonylamino]propanoic acid. InChIKey: IDONYPMIPXYFLY-JOCHJYFZSA-N.
| Molecular formula | C25H19F2NO5 |
|---|---|
| Molecular weight | 451.4 g/mol |
| IUPAC name | (2R)-3-(4-fluorophenyl)-2-[[5-(4-fluorophenyl)-1-benzofuran-2-yl]methoxycarbonylamino]propanoic acid |
| InChIKey | IDONYPMIPXYFLY-JOCHJYFZSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)NC(=O)OCC2=CC3=C(O2)C=CC(=C3)C4=CC=C(C=C4)F)F |
Computed by PubChem (NCBI)