Products 2719793-90-3
CAS 2719793-90-3 appears in our catalog under these names: RP-6306/ 99.28% (existing batch purity), RP–6306, RP-6306 98%, RP-6306, 98%, 98%, lunresertib, 99.97%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide (CAS 2719793-90-3) is a chemical compound with the molecular formula C18H20N4O2 and a molecular weight of 324.4 g/mol. IUPAC name: 2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide. InChIKey: ARBRHWRTXPWZGN-UHFFFAOYSA-N.
| Molecular formula | C18H20N4O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide |
| InChIKey | ARBRHWRTXPWZGN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)O)C)N2C(=C(C3=C2N=C(C(=C3)C)C)C(=O)N)N |
Computed by PubChem (NCBI)