cas: 947601-81-2 — see every product listed under this CAS number, including other names
Rac-(1r,2r,3s,4s)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylic acid hydrochloride, 97% (CAS 947601-81-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F659314-100MG |
| cas | 947601-81-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 830.98 Pln | |
| Fluorochem | 250mg | 1289.15 Pln | |
| Fluorochem | 1g | 3106.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R,2R,3S,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylic acid;hydrochloride (CAS 947601-81-2) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. IUPAC name: (1R,2R,3S,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylic acid;hydrochloride. InChIKey: JZBHUJIMERBHKY-MBWJBUSCSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | (1R,2R,3S,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylic acid;hydrochloride |
| InChIKey | JZBHUJIMERBHKY-MBWJBUSCSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@@H]([C@@H]2C(=O)O)N.Cl |
Computed by PubChem (NCBI)