cas: 196597-26-9 — see every product listed under this CAS number, including other names
Ramelteon 98% (CAS 196597-26-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A428570-1mg |
| cas | 196597-26-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 164.56 Pln | |
| Ambeed | 2mg | 186.81 Pln | |
| Ambeed | 5mg | 253.56 Pln | |
| Ambeed | 10mg | 303.62 Pln | |
| Ambeed | 50mg | 453.81 Pln | |
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 720.81 Pln | |
| Ambeed | 1g | 1694.25 Pln | |
| Ambeed | 5g | 5760.44 Pln | |
| Ambeed | 10g | 9175.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A428570 |
N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e]benzofuran-8-yl]ethyl]propanamide is a member of indanes.
Source: ChEBI
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChIKey | YLXDSYKOBKBWJQ-LBPRGKRZSA-N |
| SMILES | CCC(=O)NCC[C@@H]1CCC2=C1C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)