CAS 1134159-63-9 appears in our catalog under these names: Ramelteon-d5, Ramelteon-d5, 99.83%. Offered by: Chemat Brand, TargetMol, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 5 mg, 1 mg.
2,2,3,3,3-pentadeuterio-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide (CAS 1134159-63-9) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 264.37 g/mol. IUPAC name: 2,2,3,3,3-pentadeuterio-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide. InChIKey: YLXDSYKOBKBWJQ-ZDENUIFTSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 264.37 g/mol |
| IUPAC name | 2,2,3,3,3-pentadeuterio-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChIKey | YLXDSYKOBKBWJQ-ZDENUIFTSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(=O)NCC[C@@H]1CCC2=C1C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)