cas: 128232-14-4 — see every product listed under this CAS number, including other names
Raxofelast (CAS 128232-14-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg. Offered by: Chemat, MedChemExpress.
| brand | Chemat |
|---|---|
| catalog number | Ch111XVU-1mg |
| cas | 128232-14-4 |
| size | 1mg |
| availability | 0.2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 438.80 Pln | |
| Chemat | 5mg | 981.20 Pln | |
| Chemat | 10mg | 1446.80 Pln | |
| Chemat | 25mg | 2320.40 Pln | |
| Chemat | 50mg | 3242.00 Pln | |
| Chemat | 100mg | 4134.80 Pln | |
| Chemat | 200mg | 5560.40 Pln | |
| MedChemExpress | 1 mg | 858.40 Pln | |
| MedChemExpress | 10 mg | 2785.66 Pln | |
| MedChemExpress | 5 mg | 1898.65 Pln | |
| MedChemExpress | 50 mg | 6226.86 Pln | |
| MedChemExpress | 25 mg | 4462.14 Pln |
| delivery time | 3 weeks |
|---|
2-(5-acetyloxy-4,6,7-trimethyl-2,3-dihydro-1-benzofuran-2-yl)acetic acid (CAS 128232-14-4) is a chemical compound with the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. IUPAC name: 2-(5-acetyloxy-4,6,7-trimethyl-2,3-dihydro-1-benzofuran-2-yl)acetic acid. InChIKey: QLWBKUUORSULMI-UHFFFAOYSA-N.
| Molecular formula | C15H18O5 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 2-(5-acetyloxy-4,6,7-trimethyl-2,3-dihydro-1-benzofuran-2-yl)acetic acid |
| InChIKey | QLWBKUUORSULMI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)CC(=O)O)C)OC(=O)C)C |
Computed by PubChem (NCBI)