CAS 28095-18-3 appears in our catalog under these names: Peucedanol, Peucedanol methyl ether, Ulopterol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 20mg, 1mg, 2mg, 5mg, 10mg, 25mg.
6-[(2R)-2,3-dihydroxy-3-methylbutyl]-7-methoxychromen-2-one (CAS 28095-18-3) is a chemical compound with the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. IUPAC name: 6-[(2R)-2,3-dihydroxy-3-methylbutyl]-7-methoxychromen-2-one. InChIKey: BNLKKFPQJANWMM-CYBMUJFWSA-N.
| Molecular formula | C15H18O5 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 6-[(2R)-2,3-dihydroxy-3-methylbutyl]-7-methoxychromen-2-one |
| InChIKey | BNLKKFPQJANWMM-CYBMUJFWSA-N |
| SMILES | CC(C)([C@@H](CC1=C(C=C2C(=C1)C=CC(=O)O2)OC)O)O |
Computed by PubChem (NCBI)