CAS 1091621-61-2 appears in our catalog under these names: Loxoprofen Ring-opening Impurity, 4-(1-Carboxyethyl)-delta-oxo-benzenehexanoic Acid, 4–(1–Carboxyethyl)–δ–oxo–benzenehexanoic Acid, 6-(4-(1-Carboxyethyl)phenyl)-5-oxohexanoic acid 98%, 6-(4-(1-Carboxyethyl)phenyl)-5-oxohexanoic acid, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg.
6-[4-(1-carboxyethyl)phenyl]-5-oxohexanoic acid (CAS 1091621-61-2) is a chemical compound with the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. IUPAC name: 6-[4-(1-carboxyethyl)phenyl]-5-oxohexanoic acid. InChIKey: ALZUIVGLLMTAMW-UHFFFAOYSA-N.
| Molecular formula | C15H18O5 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 6-[4-(1-carboxyethyl)phenyl]-5-oxohexanoic acid |
| InChIKey | ALZUIVGLLMTAMW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)CC(=O)CCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)