Products 144980-77-8
CAS 144980-77-8 appears in our catalog under these names: Repinotan Hydrochloride, >95% (HPLC), Repinotan HCl/ 99.57% (existing batch purity), Repinotan hydrochloride, Repinotan hydrochloride, Repinotan (hydrochloride), 97.08%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 50mg, 5mg, 1mg, 10mg, 25mg, 100mg, 1 mg, 5 mg.
2-[4-[[(2R)-3,4-dihydro-2H-chromen-2-yl]methylamino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one;hydrochloride (CAS 144980-77-8) is a chemical compound with the molecular formula C21H25ClN2O4S and a molecular weight of 437.0 g/mol. IUPAC name: 2-[4-[[(2R)-3,4-dihydro-2H-chromen-2-yl]methylamino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one;hydrochloride. InChIKey: IGKYREHZJIHPML-UNTBIKODSA-N.
| Molecular formula | C21H25ClN2O4S |
|---|---|
| Molecular weight | 437.0 g/mol |
| IUPAC name | 2-[4-[[(2R)-3,4-dihydro-2H-chromen-2-yl]methylamino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one;hydrochloride |
| InChIKey | IGKYREHZJIHPML-UNTBIKODSA-N |
| SMILES | C1CC2=CC=CC=C2O[C@H]1CNCCCCN3C(=O)C4=CC=CC=C4S3(=O)=O.Cl |
Computed by PubChem (NCBI)