cas: 178307-42-1 — see every product listed under this CAS number, including other names
Revaprazan hydrochloride, 98%, 98% (CAS 178307-42-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1136XC-100mg |
| cas | 178307-42-1 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1696.40 Pln | |
| Chemat | 250mg | 3006.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride (CAS 178307-42-1) is a chemical compound with the molecular formula C22H24ClFN4 and a molecular weight of 398.9 g/mol. IUPAC name: N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride. InChIKey: MALPZYQJEDBIAK-UHFFFAOYSA-N.
| Molecular formula | C22H24ClFN4 |
|---|---|
| Molecular weight | 398.9 g/mol |
| IUPAC name | N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride |
| InChIKey | MALPZYQJEDBIAK-UHFFFAOYSA-N |
| SMILES | CC1C2=CC=CC=C2CCN1C3=NC(=NC(=C3C)C)NC4=CC=C(C=C4)F.Cl |
Computed by PubChem (NCBI)