Products 1381289-58-2
CAS 1381289-58-2 appears in our catalog under these names: 2-(1-((2-(Methylamino)pyrimidin-5-yl)methyl)piperidin-3-yl)-6-(thiophen-2-yl)pyrimidin-4(3H)-one, Ribocil, Ribocil/ 99.71% (existing batch purity), Ribocil 99%, Ribocil, 99.58%. Offered by: Chemat, GLPBio, TargetMol, Ambeed, MedChemExpress. Available pack sizes: 1mg, 25mg, 50mg, 100mg, 5mg, 10mg, 2mg, 10mM (in 1ml dmso).
2-[1-[[2-(methylamino)pyrimidin-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one (CAS 1381289-58-2) is a chemical compound with the molecular formula C19H22N6OS and a molecular weight of 382.5 g/mol. IUPAC name: 2-[1-[[2-(methylamino)pyrimidin-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one. InChIKey: ZSXCVAIJFUEGJR-UHFFFAOYSA-N.
| Molecular formula | C19H22N6OS |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 2-[1-[[2-(methylamino)pyrimidin-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one |
| InChIKey | ZSXCVAIJFUEGJR-UHFFFAOYSA-N |
| SMILES | CNC1=NC=C(C=N1)CN2CCCC(C2)C3=NC(=CC(=O)N3)C4=CC=CS4 |
Computed by PubChem (NCBI)