cas: 145783-13-7 — see every product listed under this CAS number, including other names
S-Propyl-5-nitro-2-thiobarbituric Acid 97% (CAS 145783-13-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194229-50mg |
| cas | 145783-13-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 409.31 Pln | |
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2061.38 Pln | |
| Ambeed | 5g | 9331.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A194229 |
4-hydroxy-5-nitro-2-propylsulfanyl-1H-pyrimidin-6-one (CAS 145783-13-7) is a chemical compound with the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. IUPAC name: 4-hydroxy-5-nitro-2-propylsulfanyl-1H-pyrimidin-6-one. InChIKey: PHMVMACIFWKESN-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 4-hydroxy-5-nitro-2-propylsulfanyl-1H-pyrimidin-6-one |
| InChIKey | PHMVMACIFWKESN-UHFFFAOYSA-N |
| SMILES | CCCSC1=NC(=C(C(=O)N1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)