cas: 145783-13-7 — see every product listed under this CAS number, including other names
5–Nitro–2–(propylthio)pyrimidine–4,6–diol (CAS 145783-13-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF20851-100mg |
| cas | 145783-13-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 994.88 Pln | |
| GLPBio | 1g | 2375.63 Pln | |
| GLPBio | 250mg | 1200.82 Pln | |
| GLPBio | 25g | 5417.95 Pln | |
| GLPBio | 5g | 3367.90 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-hydroxy-5-nitro-2-propylsulfanyl-1H-pyrimidin-6-one (CAS 145783-13-7) is a chemical compound with the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. IUPAC name: 4-hydroxy-5-nitro-2-propylsulfanyl-1H-pyrimidin-6-one. InChIKey: PHMVMACIFWKESN-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 4-hydroxy-5-nitro-2-propylsulfanyl-1H-pyrimidin-6-one |
| InChIKey | PHMVMACIFWKESN-UHFFFAOYSA-N |
| SMILES | CCCSC1=NC(=C(C(=O)N1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)