Products 74805-19-9
CAS 74805-19-9 is the registry number for N-(2-Amino-5-nitrophenyl)methanesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(2-amino-5-nitrophenyl)methanesulfonamide (CAS 74805-19-9) is a chemical compound with the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. IUPAC name: N-(2-amino-5-nitrophenyl)methanesulfonamide. InChIKey: CVOVBRZCMGRYCX-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | N-(2-amino-5-nitrophenyl)methanesulfonamide |
| InChIKey | CVOVBRZCMGRYCX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)