CAS 923359-38-0 appears in our catalog under these names: SAR407899, SAR407899/ 99.91% (existing batch purity), SAR407899 99%, SAR407899, 99%, 99%, SAR407899, 99.60%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 50mg, 2mg, 25mg, 1mg.
6-piperidin-4-yloxy-2H-isoquinolin-1-one (CAS 923359-38-0) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 6-piperidin-4-yloxy-2H-isoquinolin-1-one. InChIKey: IPEXHQGMTHOKQV-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 6-piperidin-4-yloxy-2H-isoquinolin-1-one |
| InChIKey | IPEXHQGMTHOKQV-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC3=C(C=C2)C(=O)NC=C3 |
Computed by PubChem (NCBI)