CAS 423148-46-3 appears in our catalog under these names: SBC–115337, SBC-115337/ 99.41% (existing batch purity), N-(4-((4-(Benzo[d]oxazol-2-yl)phenyl)carbamoyl)phenyl)benzofuran-2-carboxamide, 95%, 95%, SBC-115337, 98.02%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 100mg, 200mg, 10mM/1mL.
N-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamoyl]phenyl]-1-benzofuran-2-carboxamide (CAS 423148-46-3) is a chemical compound with the molecular formula C29H19N3O4 and a molecular weight of 473.5 g/mol. IUPAC name: N-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamoyl]phenyl]-1-benzofuran-2-carboxamide. InChIKey: ALQIZRCPSILFNQ-UHFFFAOYSA-N.
| Molecular formula | C29H19N3O4 |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | N-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamoyl]phenyl]-1-benzofuran-2-carboxamide |
| InChIKey | ALQIZRCPSILFNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C(=O)NC3=CC=C(C=C3)C(=O)NC4=CC=C(C=C4)C5=NC6=CC=CC=C6O5 |
Computed by PubChem (NCBI)