CAS 1823354-06-8 appears in our catalog under these names: SDH-IN-2, 98%, SDH-IN-2/ 99.82% (existing batch purity), SDH–IN–2, SDH-IN-2 98%, SDH-IN-2. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
N-[4-(trifluoromethyl)phenyl]prop-2-ynamide (CAS 1823354-06-8) is a chemical compound with the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. IUPAC name: N-[4-(trifluoromethyl)phenyl]prop-2-ynamide. InChIKey: CXLSLWORVFXLKL-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | N-[4-(trifluoromethyl)phenyl]prop-2-ynamide |
| InChIKey | CXLSLWORVFXLKL-UHFFFAOYSA-N |
| SMILES | C#CC(=O)NC1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)