CAS 874450-44-9 appears in our catalog under these names: SEN 12333, SEN12333/ 99.94% (existing batch purity), SEN 12333, SEN12333 98%, 5-Morpholino-N-(4-(pyridin-3-yl)phenyl)pentanamide, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 250mg, 25 mg.
5-morpholin-4-yl-N-(4-pyridin-3-ylphenyl)pentanamide (CAS 874450-44-9) is a chemical compound with the molecular formula C20H25N3O2 and a molecular weight of 339.4 g/mol. IUPAC name: 5-morpholin-4-yl-N-(4-pyridin-3-ylphenyl)pentanamide. InChIKey: XCHIZTUBUXZESJ-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O2 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 5-morpholin-4-yl-N-(4-pyridin-3-ylphenyl)pentanamide |
| InChIKey | XCHIZTUBUXZESJ-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCCCC(=O)NC2=CC=C(C=C2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)