CAS 35899-54-8 appears in our catalog under these names: SIBA/ 99.15% (existing batch purity), SIBA 99%, SIBA, 99%, 99%, SIBA, 99.64%, 5'-ISOBUTYLTHIO-5'-DEOXYADENOSINE, 99%. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(2-methylpropylsulfanylmethyl)oxolane-3,4-diol (CAS 35899-54-8) is a chemical compound with the molecular formula C14H21N5O3S and a molecular weight of 339.42 g/mol. IUPAC name: (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(2-methylpropylsulfanylmethyl)oxolane-3,4-diol. InChIKey: JDDUQGRUPLKDNT-IDTAVKCVSA-N.
| Molecular formula | C14H21N5O3S |
|---|---|
| Molecular weight | 339.42 g/mol |
| IUPAC name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(2-methylpropylsulfanylmethyl)oxolane-3,4-diol |
| InChIKey | JDDUQGRUPLKDNT-IDTAVKCVSA-N |
| SMILES | CC(C)CSC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O |
Computed by PubChem (NCBI)