Products 352554-02-0
CAS 352554-02-0 appears in our catalog under these names: SIRT1–IN–1, SIRT1-IN-1/ 99.31% (existing batch purity), SIRT1-IN-1, SIRT1-IN-1, 98.15%, SIRT1-IN-1, 97%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 500mg.
6-methyl-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide (CAS 352554-02-0) is a chemical compound with the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. IUPAC name: 6-methyl-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide. InChIKey: KQWPYXBWZWLRMZ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 6-methyl-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| InChIKey | KQWPYXBWZWLRMZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2CCCC3C(=O)N |
Computed by PubChem (NCBI)