CAS 891002-11-2 appears in our catalog under these names: SIRT6–IN–2, 5-[4-(Furan-2-amido)benzamido]-2-hydroxybenzoic acid, SIRT6-IN-2 99%, SIRT6-IN-2, 99.92%, SIRT6-IN-5/ 98.84% (existing batch purity). Offered by: GLPBio, Chemat, Ambeed, MedChemExpress, TargetMol. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 1mg, 50mg, 100mg, 200mg.
5-[[4-(furan-2-carbonylamino)benzoyl]amino]-2-hydroxybenzoic acid (CAS 891002-11-2) is a chemical compound with the molecular formula C19H14N2O6 and a molecular weight of 366.3 g/mol. IUPAC name: 5-[[4-(furan-2-carbonylamino)benzoyl]amino]-2-hydroxybenzoic acid. InChIKey: WCJCTRHTVZUWSD-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O6 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 5-[[4-(furan-2-carbonylamino)benzoyl]amino]-2-hydroxybenzoic acid |
| InChIKey | WCJCTRHTVZUWSD-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NC2=CC=C(C=C2)C(=O)NC3=CC(=C(C=C3)O)C(=O)O |
Computed by PubChem (NCBI)