SJ000063181
cas: 945189-68-4 — see every product listed under this CAS number, including other names
SJ000063181 (CAS 945189-68-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 100mg, 500mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC69903-10 |
| cas | 945189-68-4 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1299.11 Pln | |
| GLPBio | 25mg | 1916.94 Pln | |
| GLPBio | 5mg | 962.12 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1018.28 Pln | |
| GLPBio | 50mg | 2595.61 Pln | |
| Chemat | 5mg | 741.20 Pln | |
| Chemat | 10mg | 1058.00 Pln | |
| Chemat | 25mg | 1754.00 Pln | |
| Chemat | 50mg | 2589.20 Pln | |
| Chemat | 1mg | 342.80 Pln | |
| Chemat | 100mg | 3698.00 Pln | |
| Chemat | 500mg | 7566.80 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-(3-chloro-4-fluorophenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide (CAS 945189-68-4) is a chemical compound with the molecular formula C14H14ClFN2O2 and a molecular weight of 296.72 g/mol. IUPAC name: N-(3-chloro-4-fluorophenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide. InChIKey: PBZNVOPQXYXTPC-UHFFFAOYSA-N.
| Molecular formula | C14H14ClFN2O2 |
|---|---|
| Molecular weight | 296.72 g/mol |
| IUPAC name | N-(3-chloro-4-fluorophenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide |
| InChIKey | PBZNVOPQXYXTPC-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC(=NO1)C(=O)NC2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)