Products 1448428-03-2
CAS 1448428-03-2 is the registry number for Selonsertib Impurity 1. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methylbenzoic acid;hydrochloride (CAS 1448428-03-2) is a chemical compound with the molecular formula C14H14ClFN2O2 and a molecular weight of 296.72 g/mol. IUPAC name: 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methylbenzoic acid;hydrochloride. InChIKey: AXTUTVOXCLUJMK-UHFFFAOYSA-N.
| Molecular formula | C14H14ClFN2O2 |
|---|---|
| Molecular weight | 296.72 g/mol |
| IUPAC name | 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methylbenzoic acid;hydrochloride |
| InChIKey | AXTUTVOXCLUJMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N2C=C(N=C2)C3CC3)C(=O)O)F.Cl |
Computed by PubChem (NCBI)