Products 945189-68-4
CAS 945189-68-4 appears in our catalog under these names: SJ000063181/ min. 98%, SJ000063181, SJ000063181, 98.92%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
N-(3-chloro-4-fluorophenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide (CAS 945189-68-4) is a chemical compound with the molecular formula C14H14ClFN2O2 and a molecular weight of 296.72 g/mol. IUPAC name: N-(3-chloro-4-fluorophenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide. InChIKey: PBZNVOPQXYXTPC-UHFFFAOYSA-N.
| Molecular formula | C14H14ClFN2O2 |
|---|---|
| Molecular weight | 296.72 g/mol |
| IUPAC name | N-(3-chloro-4-fluorophenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide |
| InChIKey | PBZNVOPQXYXTPC-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC(=NO1)C(=O)NC2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)