CAS 1449597-34-5 appears in our catalog under these names: SMN-C3/ 98.21% (existing batch purity), SMN-C3, SMN-C3, 99.48%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 2mg.
2-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-7-(1-ethylpiperidin-4-yl)-9-methylpyrido[1,2-a]pyrimidin-4-one (CAS 1449597-34-5) is a chemical compound with the molecular formula C24H28N6O and a molecular weight of 416.5 g/mol. IUPAC name: 2-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-7-(1-ethylpiperidin-4-yl)-9-methylpyrido[1,2-a]pyrimidin-4-one. InChIKey: ZACWYYKZMLGOTG-UHFFFAOYSA-N.
| Molecular formula | C24H28N6O |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-7-(1-ethylpiperidin-4-yl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| InChIKey | ZACWYYKZMLGOTG-UHFFFAOYSA-N |
| SMILES | CCN1CCC(CC1)C2=CN3C(=O)C=C(N=C3C(=C2)C)C4=NN5C=C(N=C(C5=C4)C)C |
Computed by PubChem (NCBI)