Products 911714-45-9
CAS 911714-45-9 appears in our catalog under these names: SP-420/ 98.89% (existing batch purity), SP–420, Petadeferitrin, 99.71%, (S)-2-(2-Hydroxy-4-(2-(2-methoxyethoxy)ethoxy)phenyl)-4-methyl-4,5-dihydrothiazole-4-carboxylic acid, 98%, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
(4S)-2-[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid (CAS 911714-45-9) is a chemical compound with the molecular formula C16H21NO6S and a molecular weight of 355.4 g/mol. IUPAC name: (4S)-2-[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid. InChIKey: YASYAEVZKXPYIZ-MRXNPFEDSA-N.
| Molecular formula | C16H21NO6S |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (4S)-2-[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| InChIKey | YASYAEVZKXPYIZ-MRXNPFEDSA-N |
| SMILES | C[C@@]1(CSC(=N1)C2=C(C=C(C=C2)OCCOCCOC)O)C(=O)O |
Computed by PubChem (NCBI)