CAS 174689-39-5 appears in our catalog under these names: SR59230A, SR59230A/ 99.46% (existing batch purity), (S)-1-(2-Ethylphenoxy)-3-(((S)-1,2,3,4-tetrahydronaphthalen-1-yl)amino)propan-2-ol oxalate, 98%, 98%, SR59230A, 98.0%, SR59230A (Standard). Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
(2S)-1-(2-ethylphenoxy)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-ol;oxalic acid (CAS 174689-39-5) is a chemical compound with the molecular formula C23H29NO6 and a molecular weight of 415.5 g/mol. IUPAC name: (2S)-1-(2-ethylphenoxy)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-ol;oxalic acid. InChIKey: XTBQNQMNFXNGLR-MKSBGGEFSA-N.
| Molecular formula | C23H29NO6 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2S)-1-(2-ethylphenoxy)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-ol;oxalic acid |
| InChIKey | XTBQNQMNFXNGLR-MKSBGGEFSA-N |
| SMILES | CCC1=CC=CC=C1OC[C@H](CN[C@H]2CCCC3=CC=CC=C23)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)