CAS 1223001-53-3 appears in our catalog under these names: STK16-IN-1/ 99.84% (existing batch purity), STK16–IN–1, STK16-IN-1, STK16-IN-1, 98%, 98%, STK16-IN-1, 99.81%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 100 mg, 10mM/1mL.
1-(4-fluoro-3-methylphenyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-2-one (CAS 1223001-53-3) is a chemical compound with the molecular formula C17H12FN3O and a molecular weight of 293.29 g/mol. IUPAC name: 1-(4-fluoro-3-methylphenyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-2-one. InChIKey: WQNRDXHKVSKUPI-UHFFFAOYSA-N.
| Molecular formula | C17H12FN3O |
|---|---|
| Molecular weight | 293.29 g/mol |
| IUPAC name | 1-(4-fluoro-3-methylphenyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-2-one |
| InChIKey | WQNRDXHKVSKUPI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=O)C=CC3=CN=C4C(=C32)C=CN4)F |
Computed by PubChem (NCBI)