CAS 23256-23-7 appears in our catalog under these names: Sulfatroxazole, Sulfatroxazole-d4, 4-Amino-N-(4,5-dimethyl-3-isoxazolyl)benzenesulfonamide, ≥95%, ≥95%, SULFATROXAZOLE, ≥95%. Offered by: Dr. Ehrenstorfer, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 50mg, 500mg, 25mg, 5mg, 25 mg, 5 mg, 100 mg, 10 mg.
4-amino-N-(4,5-dimethyl-1,2-oxazol-3-yl)benzenesulfonamide (CAS 23256-23-7) is a chemical compound with the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. IUPAC name: 4-amino-N-(4,5-dimethyl-1,2-oxazol-3-yl)benzenesulfonamide. InChIKey: DAUFGBIKKGOPJA-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3S |
|---|---|
| Molecular weight | 267.31 g/mol |
| IUPAC name | 4-amino-N-(4,5-dimethyl-1,2-oxazol-3-yl)benzenesulfonamide |
| InChIKey | DAUFGBIKKGOPJA-UHFFFAOYSA-N |
| SMILES | CC1=C(ON=C1NS(=O)(=O)C2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)