Products 901872-64-8
CAS 901872-64-8 is the registry number for N-[(4-Methoxyphenyl)methyl]-1H-imidazole-4-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
N-[(4-methoxyphenyl)methyl]-1H-imidazole-5-sulfonamide (CAS 901872-64-8) is a chemical compound with the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. IUPAC name: N-[(4-methoxyphenyl)methyl]-1H-imidazole-5-sulfonamide. InChIKey: FRTKLFOZGDPRHE-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3S |
|---|---|
| Molecular weight | 267.31 g/mol |
| IUPAC name | N-[(4-methoxyphenyl)methyl]-1H-imidazole-5-sulfonamide |
| InChIKey | FRTKLFOZGDPRHE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNS(=O)(=O)C2=CN=CN2 |
Computed by PubChem (NCBI)