Products 852851-83-3
CAS 852851-83-3 is the registry number for 5-(Pyrrolidin-1-ylsulfonyl)-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-2-amine (CAS 852851-83-3) is a chemical compound with the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. IUPAC name: 5-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-2-amine. InChIKey: ONZSHSBRNGDIGQ-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3S |
|---|---|
| Molecular weight | 267.31 g/mol |
| IUPAC name | 5-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-2-amine |
| InChIKey | ONZSHSBRNGDIGQ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC3=C(C=C2)OC(=N3)N |
Computed by PubChem (NCBI)