CAS 1164470-53-4 appears in our catalog under these names: Sal 003, Sal003/ 98.58% (existing batch purity), Sal-003, Sal003 98%, Sal003, 99.00%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 2mg, 25mg, 100mg.
(E)-3-phenyl-N-[2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide (CAS 1164470-53-4) is a chemical compound with the molecular formula C18H15Cl4N3OS and a molecular weight of 463.2 g/mol. IUPAC name: (E)-3-phenyl-N-[2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide. InChIKey: TVNBASWNLOIQML-IZZDOVSWSA-N.
| Molecular formula | C18H15Cl4N3OS |
|---|---|
| Molecular weight | 463.2 g/mol |
| IUPAC name | (E)-3-phenyl-N-[2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide |
| InChIKey | TVNBASWNLOIQML-IZZDOVSWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC(C(Cl)(Cl)Cl)NC(=S)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)