Sitolactone, 95%
cas: 126784-20-1 — see every product listed under this CAS number, including other names
Sitolactone, 95% (CAS 126784-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch135W7H-100mg |
| cas | 126784-20-1 |
| size | 100mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 510.80 Pln | |
| Chemat | 50g | 683.60 Pln | |
| Chemat | 100g | 957.20 Pln | |
| Chemat | 250g | 1854.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4aR,6aS,9aS,9bS)-6a-methyl-2,4a,5,6,8,9,9a,9b-octahydro-1H-cyclopenta[f]chromene-3,7-dione (CAS 126784-20-1) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: (4aR,6aS,9aS,9bS)-6a-methyl-2,4a,5,6,8,9,9a,9b-octahydro-1H-cyclopenta[f]chromene-3,7-dione. InChIKey: IFSUJJKLAULFLL-XHSYRHOGSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | (4aR,6aS,9aS,9bS)-6a-methyl-2,4a,5,6,8,9,9a,9b-octahydro-1H-cyclopenta[f]chromene-3,7-dione |
| InChIKey | IFSUJJKLAULFLL-XHSYRHOGSA-N |
| SMILES | C[C@]12CC[C@@H]3[C@H]([C@@H]1CCC2=O)CCC(=O)O3 |
Computed by PubChem (NCBI)