Products 126784-20-1
CAS 126784-20-1 is the registry number for Sitolactone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
(4aR,6aS,9aS,9bS)-6a-methyl-2,4a,5,6,8,9,9a,9b-octahydro-1H-cyclopenta[f]chromene-3,7-dione (CAS 126784-20-1) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: (4aR,6aS,9aS,9bS)-6a-methyl-2,4a,5,6,8,9,9a,9b-octahydro-1H-cyclopenta[f]chromene-3,7-dione. InChIKey: IFSUJJKLAULFLL-XHSYRHOGSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | (4aR,6aS,9aS,9bS)-6a-methyl-2,4a,5,6,8,9,9a,9b-octahydro-1H-cyclopenta[f]chromene-3,7-dione |
| InChIKey | IFSUJJKLAULFLL-XHSYRHOGSA-N |
| SMILES | C[C@]12CC[C@@H]3[C@H]([C@@H]1CCC2=O)CCC(=O)O3 |
Computed by PubChem (NCBI)