cas: 67198-87-2 — see every product listed under this CAS number, including other names
Sodium (R)-2-((tert-butoxycarbonyl)amino)-4-hydroxybutanoate, 97%, 97% (CAS 67198-87-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FCD7-10g |
| cas | 67198-87-2 |
| size | 10g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 890.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 67198-87-2) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PZEMWPDUXBZKJN-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PZEMWPDUXBZKJN-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCO)C(=O)O |
Computed by PubChem (NCBI)