cas: 15383-56-9 — see every product listed under this CAS number, including other names
Sodium (S)-pyrrolidine-2-carboxylate, 95% (CAS 15383-56-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987852-1G |
| cas | 15383-56-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 544.62 Pln | |
| Fluorochem | 25g | 888.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Sodium (2S)-pyrrolidine-2-carboxylate (CAS 15383-56-9) is a chemical compound with the molecular formula C5H8NNaO2 and a molecular weight of 137.11 g/mol. IUPAC name: sodium (2S)-pyrrolidine-2-carboxylate. InChIKey: CUTQWXGMRNLXQC-WCCKRBBISA-M.
| Molecular formula | C5H8NNaO2 |
|---|---|
| Molecular weight | 137.11 g/mol |
| IUPAC name | sodium (2S)-pyrrolidine-2-carboxylate |
| InChIKey | CUTQWXGMRNLXQC-WCCKRBBISA-M |
| SMILES | C1C[C@H](NC1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)