cas: 89520-70-7 — see every product listed under this CAS number, including other names
Sodium 3-bromobenzenesulfinate 90% (CAS 89520-70-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A300520-100mg |
| cas | 89520-70-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1104.63 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A300520 |
Sodium 3-bromobenzenesulfinate (CAS 89520-70-7) is a chemical compound with the molecular formula C6H4BrNaO2S and a molecular weight of 243.06 g/mol. IUPAC name: sodium 3-bromobenzenesulfinate. InChIKey: LMRDXRGLFWAOLS-UHFFFAOYSA-M.
| Molecular formula | C6H4BrNaO2S |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | sodium 3-bromobenzenesulfinate |
| InChIKey | LMRDXRGLFWAOLS-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)Br)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)