CAS 89520-70-7 appears in our catalog under these names: Sodium 3-bromobenzenesulfinate, 90%, Sodium 3-bromobenzenesulfinate, Sodium 3-bromobenzenesulfinate 90%, Sodium 3-bromobenzenesulfinate, 90%, 90%, Benzenesulfinic acid, 3-bromo-, sodium salt (1:1), 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 2,5g, 100mg, 250mg.
Sodium 3-bromobenzenesulfinate (CAS 89520-70-7) is a chemical compound with the molecular formula C6H4BrNaO2S and a molecular weight of 243.06 g/mol. IUPAC name: sodium 3-bromobenzenesulfinate. InChIKey: LMRDXRGLFWAOLS-UHFFFAOYSA-M.
| Molecular formula | C6H4BrNaO2S |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | sodium 3-bromobenzenesulfinate |
| InChIKey | LMRDXRGLFWAOLS-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)Br)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)