cas: 89520-70-7 — see every product listed under this CAS number, including other names
Sodium 3-bromobenzenesulfinate, 90%, 90% (CAS 89520-70-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1198AO-100mg |
| cas | 89520-70-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 429.20 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
Sodium 3-bromobenzenesulfinate (CAS 89520-70-7) is a chemical compound with the molecular formula C6H4BrNaO2S and a molecular weight of 243.06 g/mol. IUPAC name: sodium 3-bromobenzenesulfinate. InChIKey: LMRDXRGLFWAOLS-UHFFFAOYSA-M.
| Molecular formula | C6H4BrNaO2S |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | sodium 3-bromobenzenesulfinate |
| InChIKey | LMRDXRGLFWAOLS-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)Br)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)