CAS 89520-71-8 appears in our catalog under these names: 2-Bromobenzenesulfinic acid sodium salt, 95%, Sodium 2–bromobenzene–1–sulfinate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g, 2,5g, 250mg, 50mg, 500mg.
Sodium 2-bromobenzenesulfinate (CAS 89520-71-8) is a chemical compound with the molecular formula C6H4BrNaO2S and a molecular weight of 243.06 g/mol. IUPAC name: sodium 2-bromobenzenesulfinate. InChIKey: DTXQJIIXTBYZFM-UHFFFAOYSA-M.
| Molecular formula | C6H4BrNaO2S |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | sodium 2-bromobenzenesulfinate |
| InChIKey | DTXQJIIXTBYZFM-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)S(=O)[O-])Br.[Na+] |
Computed by PubChem (NCBI)