cas: 15898-43-8 — see every product listed under this CAS number, including other names
Sodium 4-acetamidobenzenesulfinate 95% (dihydrate) (CAS 15898-43-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A262606-1g |
| cas | 15898-43-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 453.81 Pln | |
| Ambeed | 5g | 1338.25 Pln | |
| Ambeed | 10g | 2100.31 Pln | |
| Ambeed | 25g | 4141.75 Pln |
| purity | 95% (dihydrate) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A262606 |
Sodium 4-acetamidobenzenesulfinate (CAS 15898-43-8) is a chemical compound with the molecular formula C8H8NNaO3S and a molecular weight of 221.21 g/mol. IUPAC name: sodium 4-acetamidobenzenesulfinate. InChIKey: CPCFZBOTLAEGND-UHFFFAOYSA-M.
| Molecular formula | C8H8NNaO3S |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | sodium 4-acetamidobenzenesulfinate |
| InChIKey | CPCFZBOTLAEGND-UHFFFAOYSA-M |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)