Products 6882-68-4
CAS 6882-68-4 appears in our catalog under these names: (-)Sophoridine, Sophoridine/ 96.35% (existing batch purity), Sophoridine, Sophoridine, >98.0%(GC)(T), Sophoridine 96%. Offered by: TRC, TargetMol, GLPBio, TCI, Biosynth. Available pack sizes: 100mg, 1g, 20mg, 10mg, 5mg, 50mg, 250mg, 1mg.
(1R,2R,9R,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (CAS 6882-68-4) is a chemical compound with the molecular formula C15H24N2O and a molecular weight of 248.36 g/mol. IUPAC name: (1R,2R,9R,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one. InChIKey: ZSBXGIUJOOQZMP-BHPKHCPMSA-N.
| Molecular formula | C15H24N2O |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | (1R,2R,9R,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| InChIKey | ZSBXGIUJOOQZMP-BHPKHCPMSA-N |
| SMILES | C1C[C@@H]2[C@H]3CCCN4[C@H]3[C@H](CCC4)CN2C(=O)C1 |
Computed by PubChem (NCBI)
Synonyms:
Sophoridine, Sophoridin, 5-Epidihydrosophocarpine, (5-beta)-Matridin-15-one, (-)-SOPHORIDINE, (1R,2R,9R,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one, (1R,2R,9R,17S)-7,13-diazatetracyclo(7.7.1.02,7.013,17)heptadecan-6-one, Matrine, (5beta)-, Matridin-15-one, (5-beta)-, (-)Sophoridine