CAS 59864-04-9 appears in our catalog under these names: Sulindac sulfone, 95%, Sulindac Sulfone, Sulindac sulfone/ 98.19% (existing batch purity), Sulindac sulfone, 5-fluoro-2-methyl-1-[[4-(methylsulfonyl)phenyl]methylene]-1H-indene-3-acetic acid, 95%, 95%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 2,5g, 5mg, 10mg, 25mg, 50mg, 100mg.
2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]acetic acid (CAS 59864-04-9) is a chemical compound with the molecular formula C20H17FO4S and a molecular weight of 372.4 g/mol. IUPAC name: 2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]acetic acid. InChIKey: MVGSNCBCUWPVDA-RQZCQDPDSA-N.
| Molecular formula | C20H17FO4S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]acetic acid |
| InChIKey | MVGSNCBCUWPVDA-RQZCQDPDSA-N |
| SMILES | CC\1=C(C2=C(/C1=C/C3=CC=C(C=C3)S(=O)(=O)C)C=CC(=C2)F)CC(=O)O |
Computed by PubChem (NCBI)